C21H38O5Si3 — CID 70253109
(E)-3-[4-methoxy-2-[2-methyl-3-[methyl-bis(trimethylsilyloxy)silyl]propyl]phenyl]prop-2-enoic acid (PubChem CID 70253109) has the molecular formula C21H38O5Si3 and a molecular weight of 454.79 g/mol. Its IUPAC name is (E)-3-[4-methoxy-2-[2-methyl-3-[methyl-bis(trimethylsilyloxy)silyl]propyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-methoxy-2-[2-methyl-3-[methyl-bis(trimethylsilyloxy)silyl]propyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 70253109 |
| Molecular Formula | C21H38O5Si3 |
| Molecular Weight | 454.79 g/mol |
| Exact Mass | 454.20 |
| IUPAC Name | (E)-3-[4-methoxy-2-[2-methyl-3-[methyl-bis(trimethylsilyloxy)silyl]propyl]phenyl]prop-2-enoic acid |
| SMILES | COc1ccc(/C=C/C(=O)O)c(CC(C)C[Si](C)(O[Si](C)(C)C)O[Si](C)(C)C)c1 |
| InChI | InChI=1S/C21H38O5Si3/c1-17(16-29(9,25-27(3,4)5)26-28(6,7)8)14-19-15-20(24-2)12-10-18(19)11-13-21(22)23/h10-13,15,17H,14,16H2,1-9H3,(H,22,23)/b13-11+ |
| InChIKey | YJCKIEMIJJXWFX-ACCUITESSA-N |
| XLogP | 5.75 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.79 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|