About 3H-1,3-benzothiazole-2-thione;2H-triazolo[4,5-b]pyridine
3H-1,3-benzothiazole-2-thione;2H-triazolo[4,5-b]pyridine (PubChem CID 70253159) has the molecular formula C12H9N5S2
and a molecular weight of 287.37 g/mol. Its IUPAC name is 3H-1,3-benzothiazole-2-thione;2H-triazolo[4,5-b]pyridine.
Molecular Properties
| Compound Name | 3H-1,3-benzothiazole-2-thione;2H-triazolo[4,5-b]pyridine |
| PubChem CID | 70253159 |
| Molecular Formula | C12H9N5S2 |
| Molecular Weight | 287.37 g/mol |
| Exact Mass | 287.03 |
| IUPAC Name | 3H-1,3-benzothiazole-2-thione;2H-triazolo[4,5-b]pyridine |
| SMILES | S=c1[nH]c2ccccc2s1.c1cnc2n[nH]nc2c1 |
| InChI | InChI=1S/C7H5NS2.C5H4N4/c9-7-8-5-3-1-2-4-6(5)10-7;1-2-4-5(6-3-1)8-9-7-4/h1-4H,(H,8,9);1-3H,(H,6,7,8,9) |
| InChIKey | WBQQMDYSPTZDQJ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.37 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3H-1,3-benzothiazole-2-thione;2H-triazolo[4,5-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3H-1,3-benzothiazole-2-thione;2H-triazolo[4,5-b]pyridine?
The IUPAC name of 3H-1,3-benzothiazole-2-thione;2H-triazolo[4,5-b]pyridine (CID 70253159) is 3H-1,3-benzothiazole-2-thione;2H-triazolo[4,5-b]pyridine.
What is the SMILES notation for 3H-1,3-benzothiazole-2-thione;2H-triazolo[4,5-b]pyridine?
The canonical SMILES for 3H-1,3-benzothiazole-2-thione;2H-triazolo[4,5-b]pyridine is S=c1[nH]c2ccccc2s1.c1cnc2n[nH]nc2c1.
What is the InChIKey of 3H-1,3-benzothiazole-2-thione;2H-triazolo[4,5-b]pyridine?
The InChIKey is WBQQMDYSPTZDQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5NS2.C5H4N4/c9-7-8-5-3-1-2-4-6(5)10-7;1-2-4-5(6-3-1)8-9-7-4/h1-4H,(H,8,9);1-3H,(H,6,7,8,9).
What are the key properties of 3H-1,3-benzothiazole-2-thione;2H-triazolo[4,5-b]pyridine?
3H-1,3-benzothiazole-2-thione;2H-triazolo[4,5-b]pyridine has a molecular weight of 287.37 g/mol, XLogP of 3.31, 0 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3H-1,3-benzothiazole-2-thione;2H-triazolo[4,5-b]pyridine is sourced from PubChem (CID 70253159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).