C25H36O4 — CID 70253547
2-[(8R,9S,10R,13S,17R)-3',10,13-trimethylspiro[1,2,3,4,7,8,9,11,12,16-decahydrocyclopenta[a]phenanthrene-17,2'-1,4-dioxane]-12-yl]acetic acid (PubChem CID 70253547) has the molecular formula C25H36O4 and a molecular weight of 400.56 g/mol. Its IUPAC name is 2-[(8R,9S,10R,13S,17R)-3',10,13-trimethylspiro[1,2,3,4,7,8,9,11,12,16-decahydrocyclopenta[a]phenanthrene-17,2'-1,4-dioxane]-12-yl]acetic acid.
| Compound Name | 2-[(8R,9S,10R,13S,17R)-3',10,13-trimethylspiro[1,2,3,4,7,8,9,11,12,16-decahydrocyclopenta[a]phenanthrene-17,2'-1,4-dioxane]-12-yl]acetic acid |
|---|---|
| PubChem CID | 70253547 |
| Molecular Formula | C25H36O4 |
| Molecular Weight | 400.56 g/mol |
| Exact Mass | 400.26 |
| IUPAC Name | 2-[(8R,9S,10R,13S,17R)-3',10,13-trimethylspiro[1,2,3,4,7,8,9,11,12,16-decahydrocyclopenta[a]phenanthrene-17,2'-1,4-dioxane]-12-yl]acetic acid |
| SMILES | CC1OCCO[C@@]12CC=C1[C@@H]3CC=C4CCCC[C@]4(C)[C@H]3CC(CC(=O)O)[C@@]12C |
| InChI | InChI=1S/C25H36O4/c1-16-25(29-13-12-28-16)11-9-20-19-8-7-17-6-4-5-10-23(17,2)21(19)14-18(15-22(26)27)24(20,25)3/h7,9,16,18-19,21H,4-6,8,10-15H2,1-3H3,(H,26,27)/t16?,18?,19-,21-,23-,24-,25-/m0/s1 |
| InChIKey | PQDIKAVPNGPXBM-AGSKOAELSA-N |
| XLogP | 5.13 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.56 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|