bicyclo[2.2.0]hexa-1,3,5-triene;carbonic acid

C7H6O3 — CID 70253728

IUPACbicyclo[2.2.0]hexa-1,3,5-triene;carbonic acid
SMILESO=C(O)O.c1cc2ccc1-2
InChIInChI=1S/C6H4.CH2O3/c1-2-6-4-3-5(1)6;2-1(3)4/h1-4H;(H2,2,3,4)
InChIKeyXQWWFKISISOXHJ-UHFFFAOYSA-N
MW138.12 g/mol
LogP1.89
Rot. Bonds

About bicyclo[2.2.0]hexa-1,3,5-triene;carbonic acid

bicyclo[2.2.0]hexa-1,3,5-triene;carbonic acid (PubChem CID 70253728) has the molecular formula C7H6O3 and a molecular weight of 138.12 g/mol. Its IUPAC name is bicyclo[2.2.0]hexa-1,3,5-triene;carbonic acid.

Molecular Properties

Compound Namebicyclo[2.2.0]hexa-1,3,5-triene;carbonic acid
PubChem CID70253728
Molecular FormulaC7H6O3
Molecular Weight138.12 g/mol
Exact Mass138.03
IUPAC Namebicyclo[2.2.0]hexa-1,3,5-triene;carbonic acid
SMILESO=C(O)O.c1cc2ccc1-2
InChIInChI=1S/C6H4.CH2O3/c1-2-6-4-3-5(1)6;2-1(3)4/h1-4H;(H2,2,3,4)
InChIKeyXQWWFKISISOXHJ-UHFFFAOYSA-N
XLogP1.89
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors1
Rotatable Bonds
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500138.12
LogP ≤ 51.89
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 101

Analyze bicyclo[2.2.0]hexa-1,3,5-triene;carbonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of bicyclo[2.2.0]hexa-1,3,5-triene;carbonic acid?
The IUPAC name of bicyclo[2.2.0]hexa-1,3,5-triene;carbonic acid (CID 70253728) is bicyclo[2.2.0]hexa-1,3,5-triene;carbonic acid.
What is the SMILES notation for bicyclo[2.2.0]hexa-1,3,5-triene;carbonic acid?
The canonical SMILES for bicyclo[2.2.0]hexa-1,3,5-triene;carbonic acid is O=C(O)O.c1cc2ccc1-2.
What is the InChIKey of bicyclo[2.2.0]hexa-1,3,5-triene;carbonic acid?
The InChIKey is XQWWFKISISOXHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4.CH2O3/c1-2-6-4-3-5(1)6;2-1(3)4/h1-4H;(H2,2,3,4).
What are the key properties of bicyclo[2.2.0]hexa-1,3,5-triene;carbonic acid?
bicyclo[2.2.0]hexa-1,3,5-triene;carbonic acid has a molecular weight of 138.12 g/mol, XLogP of 1.89, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for bicyclo[2.2.0]hexa-1,3,5-triene;carbonic acid is sourced from PubChem (CID 70253728), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).