About N-(2-cyclohexa-2,4-dien-1-ylethyl)-1-[4-(pyridin-3-ylmethoxy)phenyl]methanimine
N-(2-cyclohexa-2,4-dien-1-ylethyl)-1-[4-(pyridin-3-ylmethoxy)phenyl]methanimine (PubChem CID 70253944) has the molecular formula C21H22N2O
and a molecular weight of 318.42 g/mol. Its IUPAC name is N-(2-cyclohexa-2,4-dien-1-ylethyl)-1-[4-(pyridin-3-ylmethoxy)phenyl]methanimine.
Molecular Properties
| Compound Name | N-(2-cyclohexa-2,4-dien-1-ylethyl)-1-[4-(pyridin-3-ylmethoxy)phenyl]methanimine |
| PubChem CID | 70253944 |
| Molecular Formula | C21H22N2O |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | N-(2-cyclohexa-2,4-dien-1-ylethyl)-1-[4-(pyridin-3-ylmethoxy)phenyl]methanimine |
| SMILES | C1=CCC(CC/N=C/c2ccc(OCc3cccnc3)cc2)C=C1 |
| InChI | InChI=1S/C21H22N2O/c1-2-5-18(6-3-1)12-14-23-15-19-8-10-21(11-9-19)24-17-20-7-4-13-22-16-20/h1-5,7-11,13,15-16,18H,6,12,14,17H2/b23-15+ |
| InChIKey | BPIPRHSCAQNHCL-HZHRSRAPSA-N |
| XLogP | 4.60 |
| TPSA | 34.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-(2-cyclohexa-2,4-dien-1-ylethyl)-1-[4-(pyridin-3-ylmethoxy)phenyl]methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-cyclohexa-2,4-dien-1-ylethyl)-1-[4-(pyridin-3-ylmethoxy)phenyl]methanimine?
The IUPAC name of N-(2-cyclohexa-2,4-dien-1-ylethyl)-1-[4-(pyridin-3-ylmethoxy)phenyl]methanimine (CID 70253944) is N-(2-cyclohexa-2,4-dien-1-ylethyl)-1-[4-(pyridin-3-ylmethoxy)phenyl]methanimine.
What is the SMILES notation for N-(2-cyclohexa-2,4-dien-1-ylethyl)-1-[4-(pyridin-3-ylmethoxy)phenyl]methanimine?
The canonical SMILES for N-(2-cyclohexa-2,4-dien-1-ylethyl)-1-[4-(pyridin-3-ylmethoxy)phenyl]methanimine is C1=CCC(CC/N=C/c2ccc(OCc3cccnc3)cc2)C=C1.
What is the InChIKey of N-(2-cyclohexa-2,4-dien-1-ylethyl)-1-[4-(pyridin-3-ylmethoxy)phenyl]methanimine?
The InChIKey is BPIPRHSCAQNHCL-HZHRSRAPSA-N. The full InChI is InChI=1S/C21H22N2O/c1-2-5-18(6-3-1)12-14-23-15-19-8-10-21(11-9-19)24-17-20-7-4-13-22-16-20/h1-5,7-11,13,15-16,18H,6,12,14,17H2/b23-15+.
What are the key properties of N-(2-cyclohexa-2,4-dien-1-ylethyl)-1-[4-(pyridin-3-ylmethoxy)phenyl]methanimine?
N-(2-cyclohexa-2,4-dien-1-ylethyl)-1-[4-(pyridin-3-ylmethoxy)phenyl]methanimine has a molecular weight of 318.42 g/mol, XLogP of 4.60, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-cyclohexa-2,4-dien-1-ylethyl)-1-[4-(pyridin-3-ylmethoxy)phenyl]methanimine is sourced from PubChem (CID 70253944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).