About 3-(2-methyl-1,2,3,4-tetrahydropyridin-5-yl)propan-1-ol
3-(2-methyl-1,2,3,4-tetrahydropyridin-5-yl)propan-1-ol (PubChem CID 70253988) has the molecular formula C9H17NO
and a molecular weight of 155.24 g/mol. Its IUPAC name is 3-(2-methyl-1,2,3,4-tetrahydropyridin-5-yl)propan-1-ol.
Analyze 3-(2-methyl-1,2,3,4-tetrahydropyridin-5-yl)propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-methyl-1,2,3,4-tetrahydropyridin-5-yl)propan-1-ol?
The IUPAC name of 3-(2-methyl-1,2,3,4-tetrahydropyridin-5-yl)propan-1-ol (CID 70253988) is 3-(2-methyl-1,2,3,4-tetrahydropyridin-5-yl)propan-1-ol.
What is the SMILES notation for 3-(2-methyl-1,2,3,4-tetrahydropyridin-5-yl)propan-1-ol?
The canonical SMILES for 3-(2-methyl-1,2,3,4-tetrahydropyridin-5-yl)propan-1-ol is CC1CCC(CCCO)=CN1.
What is the InChIKey of 3-(2-methyl-1,2,3,4-tetrahydropyridin-5-yl)propan-1-ol?
The InChIKey is AWMJIIWKKHOAMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO/c1-8-4-5-9(7-10-8)3-2-6-11/h7-8,10-11H,2-6H2,1H3.
What are the key properties of 3-(2-methyl-1,2,3,4-tetrahydropyridin-5-yl)propan-1-ol?
3-(2-methyl-1,2,3,4-tetrahydropyridin-5-yl)propan-1-ol has a molecular weight of 155.24 g/mol, XLogP of 1.41, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-methyl-1,2,3,4-tetrahydropyridin-5-yl)propan-1-ol is sourced from PubChem (CID 70253988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).