C30H37N3O7 — CID 70254003
methyl (1R,20R,24R,31S)-11,26,29-trioxo-2,25-dioxa-12,27,30-triazahexacyclo[28.2.1.03,12.05,10.014,16.020,24]tritriaconta-3,5,7,9-tetraene-31-carboxylate (PubChem CID 70254003) has the molecular formula C30H37N3O7 and a molecular weight of 551.64 g/mol. Its IUPAC name is methyl (1R,20R,24R,31S)-11,26,29-trioxo-2,25-dioxa-12,27,30-triazahexacyclo[28.2.1.03,12.05,10.014,16.020,24]tritriaconta-3,5,7,9-tetraene-31-carboxylate.
| Compound Name | methyl (1R,20R,24R,31S)-11,26,29-trioxo-2,25-dioxa-12,27,30-triazahexacyclo[28.2.1.03,12.05,10.014,16.020,24]tritriaconta-3,5,7,9-tetraene-31-carboxylate |
|---|---|
| PubChem CID | 70254003 |
| Molecular Formula | C30H37N3O7 |
| Molecular Weight | 551.64 g/mol |
| Exact Mass | 551.26 |
| IUPAC Name | methyl (1R,20R,24R,31S)-11,26,29-trioxo-2,25-dioxa-12,27,30-triazahexacyclo[28.2.1.03,12.05,10.014,16.020,24]tritriaconta-3,5,7,9-tetraene-31-carboxylate |
| SMILES | COC(=O)[C@@H]1C[C@@H]2CN1C(=O)CNC(=O)O[C@@H]1CCC[C@H]1CCCC1CC1Cn1c(cc3ccccc3c1=O)O2 |
| InChI | InChI=1S/C30H37N3O7/c1-38-29(36)24-14-22-17-32(24)26(34)15-31-30(37)40-25-11-5-8-18(25)7-4-9-19-12-21(19)16-33-27(39-22)13-20-6-2-3-10-23(20)28(33)35/h2-3,6,10,13,18-19,21-22,24-25H,4-5,7-9,11-12,14-17H2,1H3,(H,31,37)/t18-,19?,21?,22-,24+,25-/m1/s1 |
| InChIKey | GDJQLIQNHCYAJI-ZJMMQIDBSA-N |
| XLogP | 3.24 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.64 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |