About (E)-2-butyl-N'-[1-[3-methyl-5-(4-methylcyclohexyl)cyclohexyl]ethyl]prop-1-ene-1,3-diamine
(E)-2-butyl-N'-[1-[3-methyl-5-(4-methylcyclohexyl)cyclohexyl]ethyl]prop-1-ene-1,3-diamine (PubChem CID 70254094) has the molecular formula C23H44N2
and a molecular weight of 348.62 g/mol. Its IUPAC name is (E)-2-butyl-N'-[1-[3-methyl-5-(4-methylcyclohexyl)cyclohexyl]ethyl]prop-1-ene-1,3-diamine.
Molecular Properties
| Compound Name | (E)-2-butyl-N'-[1-[3-methyl-5-(4-methylcyclohexyl)cyclohexyl]ethyl]prop-1-ene-1,3-diamine |
| PubChem CID | 70254094 |
| Molecular Formula | C23H44N2 |
| Molecular Weight | 348.62 g/mol |
| Exact Mass | 348.35 |
| IUPAC Name | (E)-2-butyl-N'-[1-[3-methyl-5-(4-methylcyclohexyl)cyclohexyl]ethyl]prop-1-ene-1,3-diamine |
| SMILES | CCCC/C(=C\N)CNC(C)C1CC(C)CC(C2CCC(C)CC2)C1 |
| InChI | InChI=1S/C23H44N2/c1-5-6-7-20(15-24)16-25-19(4)22-12-18(3)13-23(14-22)21-10-8-17(2)9-11-21/h15,17-19,21-23,25H,5-14,16,24H2,1-4H3/b20-15+ |
| InChIKey | BNPJHLRZSFBZAJ-HMMYKYKNSA-N |
| XLogP | 5.88 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 348.62 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (E)-2-butyl-N'-[1-[3-methyl-5-(4-methylcyclohexyl)cyclohexyl]ethyl]prop-1-ene-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2-butyl-N'-[1-[3-methyl-5-(4-methylcyclohexyl)cyclohexyl]ethyl]prop-1-ene-1,3-diamine?
The IUPAC name of (E)-2-butyl-N'-[1-[3-methyl-5-(4-methylcyclohexyl)cyclohexyl]ethyl]prop-1-ene-1,3-diamine (CID 70254094) is (E)-2-butyl-N'-[1-[3-methyl-5-(4-methylcyclohexyl)cyclohexyl]ethyl]prop-1-ene-1,3-diamine.
What is the SMILES notation for (E)-2-butyl-N'-[1-[3-methyl-5-(4-methylcyclohexyl)cyclohexyl]ethyl]prop-1-ene-1,3-diamine?
The canonical SMILES for (E)-2-butyl-N'-[1-[3-methyl-5-(4-methylcyclohexyl)cyclohexyl]ethyl]prop-1-ene-1,3-diamine is CCCC/C(=C\N)CNC(C)C1CC(C)CC(C2CCC(C)CC2)C1.
What is the InChIKey of (E)-2-butyl-N'-[1-[3-methyl-5-(4-methylcyclohexyl)cyclohexyl]ethyl]prop-1-ene-1,3-diamine?
The InChIKey is BNPJHLRZSFBZAJ-HMMYKYKNSA-N. The full InChI is InChI=1S/C23H44N2/c1-5-6-7-20(15-24)16-25-19(4)22-12-18(3)13-23(14-22)21-10-8-17(2)9-11-21/h15,17-19,21-23,25H,5-14,16,24H2,1-4H3/b20-15+.
What are the key properties of (E)-2-butyl-N'-[1-[3-methyl-5-(4-methylcyclohexyl)cyclohexyl]ethyl]prop-1-ene-1,3-diamine?
(E)-2-butyl-N'-[1-[3-methyl-5-(4-methylcyclohexyl)cyclohexyl]ethyl]prop-1-ene-1,3-diamine has a molecular weight of 348.62 g/mol, XLogP of 5.88, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2-butyl-N'-[1-[3-methyl-5-(4-methylcyclohexyl)cyclohexyl]ethyl]prop-1-ene-1,3-diamine is sourced from PubChem (CID 70254094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).