C27H37N3O2 — CID 70254096
4-[[2-[(2S,5S)-2,5-dimethyl-4-prop-2-enylpiperazin-1-yl]-3-hydroxyphenyl]methyl]-N,N-diethylbenzamide (PubChem CID 70254096) has the molecular formula C27H37N3O2 and a molecular weight of 435.61 g/mol. Its IUPAC name is 4-[[2-[(2S,5S)-2,5-dimethyl-4-prop-2-enylpiperazin-1-yl]-3-hydroxyphenyl]methyl]-N,N-diethylbenzamide.
| Compound Name | 4-[[2-[(2S,5S)-2,5-dimethyl-4-prop-2-enylpiperazin-1-yl]-3-hydroxyphenyl]methyl]-N,N-diethylbenzamide |
|---|---|
| PubChem CID | 70254096 |
| Molecular Formula | C27H37N3O2 |
| Molecular Weight | 435.61 g/mol |
| Exact Mass | 435.29 |
| IUPAC Name | 4-[[2-[(2S,5S)-2,5-dimethyl-4-prop-2-enylpiperazin-1-yl]-3-hydroxyphenyl]methyl]-N,N-diethylbenzamide |
| SMILES | C=CCN1C[C@H](C)N(c2c(O)cccc2Cc2ccc(C(=O)N(CC)CC)cc2)C[C@@H]1C |
| InChI | InChI=1S/C27H37N3O2/c1-6-16-29-18-21(5)30(19-20(29)4)26-24(10-9-11-25(26)31)17-22-12-14-23(15-13-22)27(32)28(7-2)8-3/h6,9-15,20-21,31H,1,7-8,16-19H2,2-5H3/t20-,21-/m0/s1 |
| InChIKey | MZOZLIAEHXANBU-SFTDATJTSA-N |
| XLogP | 4.55 |
| TPSA | 47.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.61 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|