C6H8O2 — CID 70254134
1-(2,3-dihydrofuran-2-yl)ethanone (PubChem CID 70254134) has the molecular formula C6H8O2 and a molecular weight of 112.13 g/mol. Its IUPAC name is 1-(2,3-dihydrofuran-2-yl)ethanone.
| Compound Name | 1-(2,3-dihydrofuran-2-yl)ethanone |
|---|---|
| PubChem CID | 70254134 |
| Molecular Formula | C6H8O2 |
| Molecular Weight | 112.13 g/mol |
| Exact Mass | 112.05 |
| IUPAC Name | 1-(2,3-dihydrofuran-2-yl)ethanone |
| SMILES | CC(=O)C1CC=CO1 |
| InChI | InChI=1S/C6H8O2/c1-5(7)6-3-2-4-8-6/h2,4,6H,3H2,1H3 |
| InChIKey | KQXSSONNIVEWSG-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 112.13 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |