About 2-(2-oxo-2-spiro[1H-2-benzofuran-3,4'-piperidine]-1'-ylethyl)sulfanylacetic acid
2-(2-oxo-2-spiro[1H-2-benzofuran-3,4'-piperidine]-1'-ylethyl)sulfanylacetic acid (PubChem CID 70254343) has the molecular formula C16H19NO4S
and a molecular weight of 321.40 g/mol. Its IUPAC name is 2-(2-oxo-2-spiro[1H-2-benzofuran-3,4'-piperidine]-1'-ylethyl)sulfanylacetic acid.
Molecular Properties
| Compound Name | 2-(2-oxo-2-spiro[1H-2-benzofuran-3,4'-piperidine]-1'-ylethyl)sulfanylacetic acid |
| PubChem CID | 70254343 |
| Molecular Formula | C16H19NO4S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | 2-(2-oxo-2-spiro[1H-2-benzofuran-3,4'-piperidine]-1'-ylethyl)sulfanylacetic acid |
| SMILES | O=C(O)CSCC(=O)N1CCC2(CC1)OCc1ccccc12 |
| InChI | InChI=1S/C16H19NO4S/c18-14(10-22-11-15(19)20)17-7-5-16(6-8-17)13-4-2-1-3-12(13)9-21-16/h1-4H,5-11H2,(H,19,20) |
| InChIKey | ZMTLSCQXRJPUGS-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(2-oxo-2-spiro[1H-2-benzofuran-3,4'-piperidine]-1'-ylethyl)sulfanylacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-oxo-2-spiro[1H-2-benzofuran-3,4'-piperidine]-1'-ylethyl)sulfanylacetic acid?
The IUPAC name of 2-(2-oxo-2-spiro[1H-2-benzofuran-3,4'-piperidine]-1'-ylethyl)sulfanylacetic acid (CID 70254343) is 2-(2-oxo-2-spiro[1H-2-benzofuran-3,4'-piperidine]-1'-ylethyl)sulfanylacetic acid.
What is the SMILES notation for 2-(2-oxo-2-spiro[1H-2-benzofuran-3,4'-piperidine]-1'-ylethyl)sulfanylacetic acid?
The canonical SMILES for 2-(2-oxo-2-spiro[1H-2-benzofuran-3,4'-piperidine]-1'-ylethyl)sulfanylacetic acid is O=C(O)CSCC(=O)N1CCC2(CC1)OCc1ccccc12.
What is the InChIKey of 2-(2-oxo-2-spiro[1H-2-benzofuran-3,4'-piperidine]-1'-ylethyl)sulfanylacetic acid?
The InChIKey is ZMTLSCQXRJPUGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19NO4S/c18-14(10-22-11-15(19)20)17-7-5-16(6-8-17)13-4-2-1-3-12(13)9-21-16/h1-4H,5-11H2,(H,19,20).
What are the key properties of 2-(2-oxo-2-spiro[1H-2-benzofuran-3,4'-piperidine]-1'-ylethyl)sulfanylacetic acid?
2-(2-oxo-2-spiro[1H-2-benzofuran-3,4'-piperidine]-1'-ylethyl)sulfanylacetic acid has a molecular weight of 321.40 g/mol, XLogP of 1.85, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-oxo-2-spiro[1H-2-benzofuran-3,4'-piperidine]-1'-ylethyl)sulfanylacetic acid is sourced from PubChem (CID 70254343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).