About 2,3,4-triphenyl-1,2-dihydroimidazole
2,3,4-triphenyl-1,2-dihydroimidazole (PubChem CID 70254350) has the molecular formula C21H18N2
and a molecular weight of 298.39 g/mol. Its IUPAC name is 2,3,4-triphenyl-1,2-dihydroimidazole.
Molecular Properties
| Compound Name | 2,3,4-triphenyl-1,2-dihydroimidazole |
| PubChem CID | 70254350 |
| Molecular Formula | C21H18N2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | 2,3,4-triphenyl-1,2-dihydroimidazole |
| SMILES | C1=C(c2ccccc2)N(c2ccccc2)C(c2ccccc2)N1 |
| InChI | InChI=1S/C21H18N2/c1-4-10-17(11-5-1)20-16-22-21(18-12-6-2-7-13-18)23(20)19-14-8-3-9-15-19/h1-16,21-22H |
| InChIKey | ZBTWMSDUCRQONR-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,3,4-triphenyl-1,2-dihydroimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3,4-triphenyl-1,2-dihydroimidazole?
The IUPAC name of 2,3,4-triphenyl-1,2-dihydroimidazole (CID 70254350) is 2,3,4-triphenyl-1,2-dihydroimidazole.
What is the SMILES notation for 2,3,4-triphenyl-1,2-dihydroimidazole?
The canonical SMILES for 2,3,4-triphenyl-1,2-dihydroimidazole is C1=C(c2ccccc2)N(c2ccccc2)C(c2ccccc2)N1.
What is the InChIKey of 2,3,4-triphenyl-1,2-dihydroimidazole?
The InChIKey is ZBTWMSDUCRQONR-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18N2/c1-4-10-17(11-5-1)20-16-22-21(18-12-6-2-7-13-18)23(20)19-14-8-3-9-15-19/h1-16,21-22H.
What are the key properties of 2,3,4-triphenyl-1,2-dihydroimidazole?
2,3,4-triphenyl-1,2-dihydroimidazole has a molecular weight of 298.39 g/mol, XLogP of 4.79, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,4-triphenyl-1,2-dihydroimidazole is sourced from PubChem (CID 70254350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).