C21H23NO9S — CID 70254478
2-[(2S,3S,4R,5R,6R)-4,5-diacetyl-4,5-dihydroxy-6-(1-hydroxy-2-oxopropyl)-2-methylsulfanyloxan-3-yl]isoindole-1,3-dione (PubChem CID 70254478) has the molecular formula C21H23NO9S and a molecular weight of 465.48 g/mol. Its IUPAC name is 2-[(2S,3S,4R,5R,6R)-4,5-diacetyl-4,5-dihydroxy-6-(1-hydroxy-2-oxopropyl)-2-methylsulfanyloxan-3-yl]isoindole-1,3-dione.
| Compound Name | 2-[(2S,3S,4R,5R,6R)-4,5-diacetyl-4,5-dihydroxy-6-(1-hydroxy-2-oxopropyl)-2-methylsulfanyloxan-3-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 70254478 |
| Molecular Formula | C21H23NO9S |
| Molecular Weight | 465.48 g/mol |
| Exact Mass | 465.11 |
| IUPAC Name | 2-[(2S,3S,4R,5R,6R)-4,5-diacetyl-4,5-dihydroxy-6-(1-hydroxy-2-oxopropyl)-2-methylsulfanyloxan-3-yl]isoindole-1,3-dione |
| SMILES | CS[C@@H]1O[C@H](C(O)C(C)=O)[C@](O)(C(C)=O)[C@@](O)(C(C)=O)[C@@H]1N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C21H23NO9S/c1-9(23)14(26)16-21(30,11(3)25)20(29,10(2)24)15(19(31-16)32-4)22-17(27)12-7-5-6-8-13(12)18(22)28/h5-8,14-16,19,26,29-30H,1-4H3/t14?,15-,16-,19+,20-,21-/m1/s1 |
| InChIKey | MEKZJPWUAOILEP-HWLZECJNSA-N |
| XLogP | -0.67 |
| TPSA | 158.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.48 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|