C14H17F3O — CID 70254632
(2E)-5-[4-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]hepta-2,6-dien-1-ol (PubChem CID 70254632) has the molecular formula C14H17F3O and a molecular weight of 258.28 g/mol. Its IUPAC name is (2E)-5-[4-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]hepta-2,6-dien-1-ol.
| Compound Name | (2E)-5-[4-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]hepta-2,6-dien-1-ol |
|---|---|
| PubChem CID | 70254632 |
| Molecular Formula | C14H17F3O |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | (2E)-5-[4-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]hepta-2,6-dien-1-ol |
| SMILES | C=CC(C/C=C/CO)C1=CCC(C(F)(F)F)C=C1 |
| InChI | InChI=1S/C14H17F3O/c1-2-11(5-3-4-10-18)12-6-8-13(9-7-12)14(15,16)17/h2-4,6-8,11,13,18H,1,5,9-10H2/b4-3+ |
| InChIKey | JIUNZMJLDIZFIZ-ONEGZZNKSA-N |
| XLogP | 3.79 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|