C19H19F2N — CID 70254972
7,10-difluoro-2,2,4-trimethyl-1,5,10b,11-tetrahydroindeno[2,1-g]quinoline (PubChem CID 70254972) has the molecular formula C19H19F2N and a molecular weight of 299.36 g/mol. Its IUPAC name is 7,10-difluoro-2,2,4-trimethyl-1,5,10b,11-tetrahydroindeno[2,1-g]quinoline.
| Compound Name | 7,10-difluoro-2,2,4-trimethyl-1,5,10b,11-tetrahydroindeno[2,1-g]quinoline |
|---|---|
| PubChem CID | 70254972 |
| Molecular Formula | C19H19F2N |
| Molecular Weight | 299.36 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | 7,10-difluoro-2,2,4-trimethyl-1,5,10b,11-tetrahydroindeno[2,1-g]quinoline |
| SMILES | CC1=CC(C)(C)NC2=C1CC1=Cc3c(F)ccc(F)c3C1C2 |
| InChI | InChI=1S/C19H19F2N/c1-10-9-19(2,3)22-17-8-13-11(6-12(10)17)7-14-15(20)4-5-16(21)18(13)14/h4-5,7,9,13,22H,6,8H2,1-3H3 |
| InChIKey | WFBYSNCEHCNVIH-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.36 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |