C19H21NO — CID 70255183
2,2,4-trimethyl-1,3-dihydroindeno[2,1-f]quinolin-6a-ol (PubChem CID 70255183) has the molecular formula C19H21NO and a molecular weight of 279.38 g/mol. Its IUPAC name is 2,2,4-trimethyl-1,3-dihydroindeno[2,1-f]quinolin-6a-ol.
| Compound Name | 2,2,4-trimethyl-1,3-dihydroindeno[2,1-f]quinolin-6a-ol |
|---|---|
| PubChem CID | 70255183 |
| Molecular Formula | C19H21NO |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | 2,2,4-trimethyl-1,3-dihydroindeno[2,1-f]quinolin-6a-ol |
| SMILES | CN1CC(C)(C)CC2=C1C=CC1(O)C2=Cc2ccccc21 |
| InChI | InChI=1S/C19H21NO/c1-18(2)11-14-16-10-13-6-4-5-7-15(13)19(16,21)9-8-17(14)20(3)12-18/h4-10,21H,11-12H2,1-3H3 |
| InChIKey | ANQDVGSQQWPURY-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |