C16H22O2S — CID 70255200
1-[(1S,2S)-2-cyclohexylcyclopropyl]-4-methylsulfonylbenzene (PubChem CID 70255200) has the molecular formula C16H22O2S and a molecular weight of 278.42 g/mol. Its IUPAC name is 1-[(1S,2S)-2-cyclohexylcyclopropyl]-4-methylsulfonylbenzene.
| Compound Name | 1-[(1S,2S)-2-cyclohexylcyclopropyl]-4-methylsulfonylbenzene |
|---|---|
| PubChem CID | 70255200 |
| Molecular Formula | C16H22O2S |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 1-[(1S,2S)-2-cyclohexylcyclopropyl]-4-methylsulfonylbenzene |
| SMILES | CS(=O)(=O)c1ccc([C@H]2C[C@H]2C2CCCCC2)cc1 |
| InChI | InChI=1S/C16H22O2S/c1-19(17,18)14-9-7-13(8-10-14)16-11-15(16)12-5-3-2-4-6-12/h7-10,12,15-16H,2-6,11H2,1H3/t15-,16+/m0/s1 |
| InChIKey | DXNDULPRUSOLTA-JKSUJKDBSA-N |
| XLogP | 3.77 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |