About 1-methylcyclopent-2-ene-1,2-diol
1-methylcyclopent-2-ene-1,2-diol (PubChem CID 70255213) has the molecular formula C6H10O2
and a molecular weight of 114.14 g/mol. Its IUPAC name is 1-methylcyclopent-2-ene-1,2-diol.
Molecular Properties
| Compound Name | 1-methylcyclopent-2-ene-1,2-diol |
| PubChem CID | 70255213 |
| Molecular Formula | C6H10O2 |
| Molecular Weight | 114.14 g/mol |
| Exact Mass | 114.07 |
| IUPAC Name | 1-methylcyclopent-2-ene-1,2-diol |
| SMILES | CC1(O)CCC=C1O |
| InChI | InChI=1S/C6H10O2/c1-6(8)4-2-3-5(6)7/h3,7-8H,2,4H2,1H3 |
| InChIKey | XPWIZMIBBTZWPN-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.14 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-methylcyclopent-2-ene-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylcyclopent-2-ene-1,2-diol?
The IUPAC name of 1-methylcyclopent-2-ene-1,2-diol (CID 70255213) is 1-methylcyclopent-2-ene-1,2-diol.
What is the SMILES notation for 1-methylcyclopent-2-ene-1,2-diol?
The canonical SMILES for 1-methylcyclopent-2-ene-1,2-diol is CC1(O)CCC=C1O.
What is the InChIKey of 1-methylcyclopent-2-ene-1,2-diol?
The InChIKey is XPWIZMIBBTZWPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O2/c1-6(8)4-2-3-5(6)7/h3,7-8H,2,4H2,1H3.
What are the key properties of 1-methylcyclopent-2-ene-1,2-diol?
1-methylcyclopent-2-ene-1,2-diol has a molecular weight of 114.14 g/mol, XLogP of 0.97, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylcyclopent-2-ene-1,2-diol is sourced from PubChem (CID 70255213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).