C20H19F4N3O4S — CID 70255339
3-[4-amino-3-(trifluoromethyl)phenyl]-1-[(5-fluoro-2-methylsulfonylphenyl)methyl]-5,5-dimethylimidazolidine-2,4-dione (PubChem CID 70255339) has the molecular formula C20H19F4N3O4S and a molecular weight of 473.45 g/mol. Its IUPAC name is 3-[4-amino-3-(trifluoromethyl)phenyl]-1-[(5-fluoro-2-methylsulfonylphenyl)methyl]-5,5-dimethylimidazolidine-2,4-dione.
| Compound Name | 3-[4-amino-3-(trifluoromethyl)phenyl]-1-[(5-fluoro-2-methylsulfonylphenyl)methyl]-5,5-dimethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 70255339 |
| Molecular Formula | C20H19F4N3O4S |
| Molecular Weight | 473.45 g/mol |
| Exact Mass | 473.10 |
| IUPAC Name | 3-[4-amino-3-(trifluoromethyl)phenyl]-1-[(5-fluoro-2-methylsulfonylphenyl)methyl]-5,5-dimethylimidazolidine-2,4-dione |
| SMILES | CC1(C)C(=O)N(c2ccc(N)c(C(F)(F)F)c2)C(=O)N1Cc1cc(F)ccc1S(C)(=O)=O |
| InChI | InChI=1S/C20H19F4N3O4S/c1-19(2)17(28)27(13-5-6-15(25)14(9-13)20(22,23)24)18(29)26(19)10-11-8-12(21)4-7-16(11)32(3,30)31/h4-9H,10,25H2,1-3H3 |
| InChIKey | WEXRSWFRGXPPGQ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 100.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.45 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_K(2)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|