C16H20N2O2 — CID 70255341
[(6aR,9S,10aS)-10a-methoxy-6,6a,7,8,9,10-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]methanol (PubChem CID 70255341) has the molecular formula C16H20N2O2 and a molecular weight of 272.35 g/mol. Its IUPAC name is [(6aR,9S,10aS)-10a-methoxy-6,6a,7,8,9,10-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]methanol.
| Compound Name | [(6aR,9S,10aS)-10a-methoxy-6,6a,7,8,9,10-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]methanol |
|---|---|
| PubChem CID | 70255341 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | [(6aR,9S,10aS)-10a-methoxy-6,6a,7,8,9,10-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]methanol |
| SMILES | CO[C@]12C[C@H](CO)CN[C@@H]1Cc1c[nH]c3cccc2c13 |
| InChI | InChI=1S/C16H20N2O2/c1-20-16-6-10(9-19)7-18-14(16)5-11-8-17-13-4-2-3-12(16)15(11)13/h2-4,8,10,14,17-19H,5-7,9H2,1H3/t10-,14+,16-/m0/s1 |
| InChIKey | XYCZJXAMCYFSDE-JJMVLAAESA-N |
| XLogP | 1.54 |
| TPSA | 57.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |