C10H18N4O4 — CID 70255478
(2S)-2,6-diaminohexanoic acid;1H-pyrimidine-2,4-dione (PubChem CID 70255478) has the molecular formula C10H18N4O4 and a molecular weight of 258.28 g/mol. Its IUPAC name is (2S)-2,6-diaminohexanoic acid;1H-pyrimidine-2,4-dione.
| Compound Name | (2S)-2,6-diaminohexanoic acid;1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 70255478 |
| Molecular Formula | C10H18N4O4 |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | (2S)-2,6-diaminohexanoic acid;1H-pyrimidine-2,4-dione |
| SMILES | NCCCC[C@H](N)C(=O)O.O=c1cc[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C6H14N2O2.C4H4N2O2/c7-4-2-1-3-5(8)6(9)10;7-3-1-2-5-4(8)6-3/h5H,1-4,7-8H2,(H,9,10);1-2H,(H2,5,6,7,8)/t5-;/m0./s1 |
| InChIKey | BVUMZXXIZFCPAU-JEDNCBNOSA-N |
| XLogP | -1.41 |
| TPSA | 155.06 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|