About [[2-(4,4-diphenylbutyl)phenyl]-dimethylsilyl]oxyboronic acid
[[2-(4,4-diphenylbutyl)phenyl]-dimethylsilyl]oxyboronic acid (PubChem CID 70256099) has the molecular formula C24H29BO3Si
and a molecular weight of 404.39 g/mol. Its IUPAC name is [[2-(4,4-diphenylbutyl)phenyl]-dimethylsilyl]oxyboronic acid.
Molecular Properties
| Compound Name | [[2-(4,4-diphenylbutyl)phenyl]-dimethylsilyl]oxyboronic acid |
| PubChem CID | 70256099 |
| Molecular Formula | C24H29BO3Si |
| Molecular Weight | 404.39 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | [[2-(4,4-diphenylbutyl)phenyl]-dimethylsilyl]oxyboronic acid |
| SMILES | C[Si](C)(OB(O)O)c1ccccc1CCCC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H29BO3Si/c1-29(2,28-25(26)27)24-19-10-9-16-22(24)17-11-18-23(20-12-5-3-6-13-20)21-14-7-4-8-15-21/h3-10,12-16,19,23,26-27H,11,17-18H2,1-2H3 |
| InChIKey | JOSWRYJVEVDBAK-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.39 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [[2-(4,4-diphenylbutyl)phenyl]-dimethylsilyl]oxyboronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[2-(4,4-diphenylbutyl)phenyl]-dimethylsilyl]oxyboronic acid?
The IUPAC name of [[2-(4,4-diphenylbutyl)phenyl]-dimethylsilyl]oxyboronic acid (CID 70256099) is [[2-(4,4-diphenylbutyl)phenyl]-dimethylsilyl]oxyboronic acid.
What is the SMILES notation for [[2-(4,4-diphenylbutyl)phenyl]-dimethylsilyl]oxyboronic acid?
The canonical SMILES for [[2-(4,4-diphenylbutyl)phenyl]-dimethylsilyl]oxyboronic acid is C[Si](C)(OB(O)O)c1ccccc1CCCC(c1ccccc1)c1ccccc1.
What is the InChIKey of [[2-(4,4-diphenylbutyl)phenyl]-dimethylsilyl]oxyboronic acid?
The InChIKey is JOSWRYJVEVDBAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H29BO3Si/c1-29(2,28-25(26)27)24-19-10-9-16-22(24)17-11-18-23(20-12-5-3-6-13-20)21-14-7-4-8-15-21/h3-10,12-16,19,23,26-27H,11,17-18H2,1-2H3.
What are the key properties of [[2-(4,4-diphenylbutyl)phenyl]-dimethylsilyl]oxyboronic acid?
[[2-(4,4-diphenylbutyl)phenyl]-dimethylsilyl]oxyboronic acid has a molecular weight of 404.39 g/mol, XLogP of 4.24, 9 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [[2-(4,4-diphenylbutyl)phenyl]-dimethylsilyl]oxyboronic acid is sourced from PubChem (CID 70256099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).