C18H24N6 — CID 70256275
(1R,14R)-6,9,15,18,21,24-hexazatetracyclo[12.10.0.02,7.08,13]tetracosa-2(7),3,5,8(13),9,11-hexaene (PubChem CID 70256275) has the molecular formula C18H24N6 and a molecular weight of 324.43 g/mol. Its IUPAC name is (1R,14R)-6,9,15,18,21,24-hexazatetracyclo[12.10.0.02,7.08,13]tetracosa-2(7),3,5,8(13),9,11-hexaene.
| Compound Name | (1R,14R)-6,9,15,18,21,24-hexazatetracyclo[12.10.0.02,7.08,13]tetracosa-2(7),3,5,8(13),9,11-hexaene |
|---|---|
| PubChem CID | 70256275 |
| Molecular Formula | C18H24N6 |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 324.21 |
| IUPAC Name | (1R,14R)-6,9,15,18,21,24-hexazatetracyclo[12.10.0.02,7.08,13]tetracosa-2(7),3,5,8(13),9,11-hexaene |
| SMILES | c1cnc2c(c1)[C@H]1NCCNCCNCCN[C@@H]1c1cccnc1-2 |
| InChI | InChI=1S/C18H24N6/c1-3-13-15(21-5-1)16-14(4-2-6-22-16)18-17(13)23-11-9-19-7-8-20-10-12-24-18/h1-6,17-20,23-24H,7-12H2/t17-,18-/m1/s1 |
| InChIKey | AUWBRPVRNXNAFT-QZTJIDSGSA-N |
| XLogP | 0.61 |
| TPSA | 73.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |