C16H14N4 — CID 70256476
3-phenyl-5,6-dihydro-4H-triazolo[1,5-a][1,4]benzodiazepine (PubChem CID 70256476) has the molecular formula C16H14N4 and a molecular weight of 262.32 g/mol. Its IUPAC name is 3-phenyl-5,6-dihydro-4H-triazolo[1,5-a][1,4]benzodiazepine.
| Compound Name | 3-phenyl-5,6-dihydro-4H-triazolo[1,5-a][1,4]benzodiazepine |
|---|---|
| PubChem CID | 70256476 |
| Molecular Formula | C16H14N4 |
| Molecular Weight | 262.32 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | 3-phenyl-5,6-dihydro-4H-triazolo[1,5-a][1,4]benzodiazepine |
| SMILES | c1ccc(-c2nnn3c2CNCc2ccccc2-3)cc1 |
| InChI | InChI=1S/C16H14N4/c1-2-6-12(7-3-1)16-15-11-17-10-13-8-4-5-9-14(13)20(15)19-18-16/h1-9,17H,10-11H2 |
| InChIKey | LKMRTLWBGRQILW-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.32 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |