About 3-methyl-4,5-dioxo-3-(oxolan-2-yl)cyclohexene-1,2-dicarboxylic acid
3-methyl-4,5-dioxo-3-(oxolan-2-yl)cyclohexene-1,2-dicarboxylic acid (PubChem CID 70256880) has the molecular formula C13H14O7
and a molecular weight of 282.25 g/mol. Its IUPAC name is 3-methyl-4,5-dioxo-3-(oxolan-2-yl)cyclohexene-1,2-dicarboxylic acid.
Molecular Properties
| Compound Name | 3-methyl-4,5-dioxo-3-(oxolan-2-yl)cyclohexene-1,2-dicarboxylic acid |
| PubChem CID | 70256880 |
| Molecular Formula | C13H14O7 |
| Molecular Weight | 282.25 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | 3-methyl-4,5-dioxo-3-(oxolan-2-yl)cyclohexene-1,2-dicarboxylic acid |
| SMILES | CC1(C2CCCO2)C(=O)C(=O)CC(C(=O)O)=C1C(=O)O |
| InChI | InChI=1S/C13H14O7/c1-13(8-3-2-4-20-8)9(12(18)19)6(11(16)17)5-7(14)10(13)15/h8H,2-5H2,1H3,(H,16,17)(H,18,19) |
| InChIKey | PNGMVRSRGWTXQF-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 117.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.25 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-4,5-dioxo-3-(oxolan-2-yl)cyclohexene-1,2-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-4,5-dioxo-3-(oxolan-2-yl)cyclohexene-1,2-dicarboxylic acid?
The IUPAC name of 3-methyl-4,5-dioxo-3-(oxolan-2-yl)cyclohexene-1,2-dicarboxylic acid (CID 70256880) is 3-methyl-4,5-dioxo-3-(oxolan-2-yl)cyclohexene-1,2-dicarboxylic acid.
What is the SMILES notation for 3-methyl-4,5-dioxo-3-(oxolan-2-yl)cyclohexene-1,2-dicarboxylic acid?
The canonical SMILES for 3-methyl-4,5-dioxo-3-(oxolan-2-yl)cyclohexene-1,2-dicarboxylic acid is CC1(C2CCCO2)C(=O)C(=O)CC(C(=O)O)=C1C(=O)O.
What is the InChIKey of 3-methyl-4,5-dioxo-3-(oxolan-2-yl)cyclohexene-1,2-dicarboxylic acid?
The InChIKey is PNGMVRSRGWTXQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14O7/c1-13(8-3-2-4-20-8)9(12(18)19)6(11(16)17)5-7(14)10(13)15/h8H,2-5H2,1H3,(H,16,17)(H,18,19).
What are the key properties of 3-methyl-4,5-dioxo-3-(oxolan-2-yl)cyclohexene-1,2-dicarboxylic acid?
3-methyl-4,5-dioxo-3-(oxolan-2-yl)cyclohexene-1,2-dicarboxylic acid has a molecular weight of 282.25 g/mol, XLogP of 0.18, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-4,5-dioxo-3-(oxolan-2-yl)cyclohexene-1,2-dicarboxylic acid is sourced from PubChem (CID 70256880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).