About 1,3-dipyridin-2-ylthiourea
1,3-dipyridin-2-ylthiourea (PubChem CID 702572) has the molecular formula C11H10N4S
and a molecular weight of 230.30 g/mol. Its IUPAC name is 1,3-dipyridin-2-ylthiourea.
Molecular Properties
| Compound Name | 1,3-dipyridin-2-ylthiourea |
| PubChem CID | 702572 |
| Molecular Formula | C11H10N4S |
| Molecular Weight | 230.30 g/mol |
| Exact Mass | 230.06 |
| IUPAC Name | 1,3-dipyridin-2-ylthiourea |
| SMILES | S=C(Nc1ccccn1)Nc1ccccn1 |
| InChI | InChI=1S/C11H10N4S/c16-11(14-9-5-1-3-7-12-9)15-10-6-2-4-8-13-10/h1-8H,(H2,12,13,14,15,16) |
| InChIKey | VADXORVZZWERFF-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.30 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dipyridin-2-ylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dipyridin-2-ylthiourea?
The IUPAC name of 1,3-dipyridin-2-ylthiourea (CID 702572) is 1,3-dipyridin-2-ylthiourea.
What is the SMILES notation for 1,3-dipyridin-2-ylthiourea?
The canonical SMILES for 1,3-dipyridin-2-ylthiourea is S=C(Nc1ccccn1)Nc1ccccn1.
What is the InChIKey of 1,3-dipyridin-2-ylthiourea?
The InChIKey is VADXORVZZWERFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N4S/c16-11(14-9-5-1-3-7-12-9)15-10-6-2-4-8-13-10/h1-8H,(H2,12,13,14,15,16).
What are the key properties of 1,3-dipyridin-2-ylthiourea?
1,3-dipyridin-2-ylthiourea has a molecular weight of 230.30 g/mol, XLogP of 2.29, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dipyridin-2-ylthiourea is sourced from PubChem (CID 702572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).