About 5-methyl-N,N,4-tripropyloctan-4-amine;morpholine
5-methyl-N,N,4-tripropyloctan-4-amine;morpholine (PubChem CID 70257425) has the molecular formula C22H48N2O
and a molecular weight of 356.64 g/mol. Its IUPAC name is 5-methyl-N,N,4-tripropyloctan-4-amine;morpholine.
Molecular Properties
| Compound Name | 5-methyl-N,N,4-tripropyloctan-4-amine;morpholine |
| PubChem CID | 70257425 |
| Molecular Formula | C22H48N2O |
| Molecular Weight | 356.64 g/mol |
| Exact Mass | 356.38 |
| IUPAC Name | 5-methyl-N,N,4-tripropyloctan-4-amine;morpholine |
| SMILES | C1COCCN1.CCCC(C)C(CCC)(CCC)N(CCC)CCC |
| InChI | InChI=1S/C18H39N.C4H9NO/c1-7-12-17(6)18(13-8-2,14-9-3)19(15-10-4)16-11-5;1-3-6-4-2-5-1/h17H,7-16H2,1-6H3;5H,1-4H2 |
| InChIKey | QGAOQODSMCXCLI-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 356.64 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-methyl-N,N,4-tripropyloctan-4-amine;morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-N,N,4-tripropyloctan-4-amine;morpholine?
The IUPAC name of 5-methyl-N,N,4-tripropyloctan-4-amine;morpholine (CID 70257425) is 5-methyl-N,N,4-tripropyloctan-4-amine;morpholine.
What is the SMILES notation for 5-methyl-N,N,4-tripropyloctan-4-amine;morpholine?
The canonical SMILES for 5-methyl-N,N,4-tripropyloctan-4-amine;morpholine is C1COCCN1.CCCC(C)C(CCC)(CCC)N(CCC)CCC.
What is the InChIKey of 5-methyl-N,N,4-tripropyloctan-4-amine;morpholine?
The InChIKey is QGAOQODSMCXCLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H39N.C4H9NO/c1-7-12-17(6)18(13-8-2,14-9-3)19(15-10-4)16-11-5;1-3-6-4-2-5-1/h17H,7-16H2,1-6H3;5H,1-4H2.
What are the key properties of 5-methyl-N,N,4-tripropyloctan-4-amine;morpholine?
5-methyl-N,N,4-tripropyloctan-4-amine;morpholine has a molecular weight of 356.64 g/mol, XLogP of 5.49, 12 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-N,N,4-tripropyloctan-4-amine;morpholine is sourced from PubChem (CID 70257425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).