C24H19FN2O2 — CID 7025776
(5R)-7-fluoro-5-phenyl-4-(3-phenylprop-2-enoyl)-3,5-dihydro-1H-1,4-benzodiazepin-2-one (PubChem CID 7025776) has the molecular formula C24H19FN2O2 and a molecular weight of 386.43 g/mol. Its IUPAC name is (5R)-7-fluoro-5-phenyl-4-(3-phenylprop-2-enoyl)-3,5-dihydro-1H-1,4-benzodiazepin-2-one.
| Compound Name | (5R)-7-fluoro-5-phenyl-4-(3-phenylprop-2-enoyl)-3,5-dihydro-1H-1,4-benzodiazepin-2-one |
|---|---|
| PubChem CID | 7025776 |
| Molecular Formula | C24H19FN2O2 |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | (5R)-7-fluoro-5-phenyl-4-(3-phenylprop-2-enoyl)-3,5-dihydro-1H-1,4-benzodiazepin-2-one |
| SMILES | O=C1CN(C(=O)C=Cc2ccccc2)[C@H](c2ccccc2)c2cc(F)ccc2N1 |
| InChI | InChI=1S/C24H19FN2O2/c25-19-12-13-21-20(15-19)24(18-9-5-2-6-10-18)27(16-22(28)26-21)23(29)14-11-17-7-3-1-4-8-17/h1-15,24H,16H2,(H,26,28)/t24-/m1/s1 |
| InChIKey | QWNBJDBLVWADDB-XMMPIXPASA-N |
| XLogP | 4.41 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|