C26H40O8Si — CID 70258248
2-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,5,5-tris(hydroxymethyl)hexane-1,3,4,6-tetrol (PubChem CID 70258248) has the molecular formula C26H40O8Si and a molecular weight of 508.68 g/mol. Its IUPAC name is 2-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,5,5-tris(hydroxymethyl)hexane-1,3,4,6-tetrol.
| Compound Name | 2-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,5,5-tris(hydroxymethyl)hexane-1,3,4,6-tetrol |
|---|---|
| PubChem CID | 70258248 |
| Molecular Formula | C26H40O8Si |
| Molecular Weight | 508.68 g/mol |
| Exact Mass | 508.25 |
| IUPAC Name | 2-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,5,5-tris(hydroxymethyl)hexane-1,3,4,6-tetrol |
| SMILES | CC(C)(C)[Si](OCC(CO)(CO)C(O)C(O)C(CO)(CO)CO)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H40O8Si/c1-24(2,3)35(20-10-6-4-7-11-20,21-12-8-5-9-13-21)34-19-26(17-30,18-31)23(33)22(32)25(14-27,15-28)16-29/h4-13,22-23,27-33H,14-19H2,1-3H3 |
| InChIKey | CQBXRNIFYHFFCR-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 150.84 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.68 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|