About 5-methyl-1,4,6,7-tetrahydropyrrolo[3,2-c]pyridine
5-methyl-1,4,6,7-tetrahydropyrrolo[3,2-c]pyridine (PubChem CID 70258346) has the molecular formula C8H12N2
and a molecular weight of 136.20 g/mol. Its IUPAC name is 5-methyl-1,4,6,7-tetrahydropyrrolo[3,2-c]pyridine.
Analyze 5-methyl-1,4,6,7-tetrahydropyrrolo[3,2-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-1,4,6,7-tetrahydropyrrolo[3,2-c]pyridine?
The IUPAC name of 5-methyl-1,4,6,7-tetrahydropyrrolo[3,2-c]pyridine (CID 70258346) is 5-methyl-1,4,6,7-tetrahydropyrrolo[3,2-c]pyridine.
What is the SMILES notation for 5-methyl-1,4,6,7-tetrahydropyrrolo[3,2-c]pyridine?
The canonical SMILES for 5-methyl-1,4,6,7-tetrahydropyrrolo[3,2-c]pyridine is CN1CCc2[nH]ccc2C1.
What is the InChIKey of 5-methyl-1,4,6,7-tetrahydropyrrolo[3,2-c]pyridine?
The InChIKey is LUGQMYIRDTXXAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2/c1-10-5-3-8-7(6-10)2-4-9-8/h2,4,9H,3,5-6H2,1H3.
What are the key properties of 5-methyl-1,4,6,7-tetrahydropyrrolo[3,2-c]pyridine?
5-methyl-1,4,6,7-tetrahydropyrrolo[3,2-c]pyridine has a molecular weight of 136.20 g/mol, XLogP of 1.00, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-1,4,6,7-tetrahydropyrrolo[3,2-c]pyridine is sourced from PubChem (CID 70258346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).