C13H16FNO2 — CID 70258489
(6aS)-6a-(2-fluorophenyl)-5-methoxy-1,3,3a,4,5,6-hexahydrocyclopenta[c][1,2]oxazole (PubChem CID 70258489) has the molecular formula C13H16FNO2 and a molecular weight of 237.27 g/mol. Its IUPAC name is (6aS)-6a-(2-fluorophenyl)-5-methoxy-1,3,3a,4,5,6-hexahydrocyclopenta[c][1,2]oxazole.
| Compound Name | (6aS)-6a-(2-fluorophenyl)-5-methoxy-1,3,3a,4,5,6-hexahydrocyclopenta[c][1,2]oxazole |
|---|---|
| PubChem CID | 70258489 |
| Molecular Formula | C13H16FNO2 |
| Molecular Weight | 237.27 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | (6aS)-6a-(2-fluorophenyl)-5-methoxy-1,3,3a,4,5,6-hexahydrocyclopenta[c][1,2]oxazole |
| SMILES | COC1CC2CON[C@@]2(c2ccccc2F)C1 |
| InChI | InChI=1S/C13H16FNO2/c1-16-10-6-9-8-17-15-13(9,7-10)11-4-2-3-5-12(11)14/h2-5,9-10,15H,6-8H2,1H3/t9?,10?,13-/m0/s1 |
| InChIKey | GHGJEMOCXGFTFX-ZPPKWKGLSA-N |
| XLogP | 1.98 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.27 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |