About 5-fluoro-1,2-dimethyl-3,4-dihydro-1H-isoquinoline
5-fluoro-1,2-dimethyl-3,4-dihydro-1H-isoquinoline (PubChem CID 70259099) has the molecular formula C11H14FN
and a molecular weight of 179.24 g/mol. Its IUPAC name is 5-fluoro-1,2-dimethyl-3,4-dihydro-1H-isoquinoline.
Molecular Properties
| Compound Name | 5-fluoro-1,2-dimethyl-3,4-dihydro-1H-isoquinoline |
| PubChem CID | 70259099 |
| Molecular Formula | C11H14FN |
| Molecular Weight | 179.24 g/mol |
| Exact Mass | 179.11 |
| IUPAC Name | 5-fluoro-1,2-dimethyl-3,4-dihydro-1H-isoquinoline |
| SMILES | CC1c2cccc(F)c2CCN1C |
| InChI | InChI=1S/C11H14FN/c1-8-9-4-3-5-11(12)10(9)6-7-13(8)2/h3-5,8H,6-7H2,1-2H3 |
| InChIKey | UUODGMREILRFRP-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.24 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-fluoro-1,2-dimethyl-3,4-dihydro-1H-isoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-1,2-dimethyl-3,4-dihydro-1H-isoquinoline?
The IUPAC name of 5-fluoro-1,2-dimethyl-3,4-dihydro-1H-isoquinoline (CID 70259099) is 5-fluoro-1,2-dimethyl-3,4-dihydro-1H-isoquinoline.
What is the SMILES notation for 5-fluoro-1,2-dimethyl-3,4-dihydro-1H-isoquinoline?
The canonical SMILES for 5-fluoro-1,2-dimethyl-3,4-dihydro-1H-isoquinoline is CC1c2cccc(F)c2CCN1C.
What is the InChIKey of 5-fluoro-1,2-dimethyl-3,4-dihydro-1H-isoquinoline?
The InChIKey is UUODGMREILRFRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14FN/c1-8-9-4-3-5-11(12)10(9)6-7-13(8)2/h3-5,8H,6-7H2,1-2H3.
What are the key properties of 5-fluoro-1,2-dimethyl-3,4-dihydro-1H-isoquinoline?
5-fluoro-1,2-dimethyl-3,4-dihydro-1H-isoquinoline has a molecular weight of 179.24 g/mol, XLogP of 2.37, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-1,2-dimethyl-3,4-dihydro-1H-isoquinoline is sourced from PubChem (CID 70259099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).