C19H25FN2O4S — CID 70259116
tert-butyl N-[(7R)-8a-(2-fluorophenyl)-7-(hydroxymethyl)-4a,5,7,8-tetrahydro-4H-pyrano[4,3-d][1,3]thiazin-2-yl]carbamate (PubChem CID 70259116) has the molecular formula C19H25FN2O4S and a molecular weight of 396.48 g/mol. Its IUPAC name is tert-butyl N-[(7R)-8a-(2-fluorophenyl)-7-(hydroxymethyl)-4a,5,7,8-tetrahydro-4H-pyrano[4,3-d][1,3]thiazin-2-yl]carbamate.
| Compound Name | tert-butyl N-[(7R)-8a-(2-fluorophenyl)-7-(hydroxymethyl)-4a,5,7,8-tetrahydro-4H-pyrano[4,3-d][1,3]thiazin-2-yl]carbamate |
|---|---|
| PubChem CID | 70259116 |
| Molecular Formula | C19H25FN2O4S |
| Molecular Weight | 396.48 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | tert-butyl N-[(7R)-8a-(2-fluorophenyl)-7-(hydroxymethyl)-4a,5,7,8-tetrahydro-4H-pyrano[4,3-d][1,3]thiazin-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1=NC2(c3ccccc3F)C[C@H](CO)OCC2CS1 |
| InChI | InChI=1S/C19H25FN2O4S/c1-18(2,3)26-17(24)21-16-22-19(14-6-4-5-7-15(14)20)8-13(9-23)25-10-12(19)11-27-16/h4-7,12-13,23H,8-11H2,1-3H3,(H,21,22,24)/t12?,13-,19?/m1/s1 |
| InChIKey | WYRLMAGPNNSOHC-FWHMADFJSA-N |
| XLogP | 3.05 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.48 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |