About 3-ethenyl-4a,8a-dihydroquinoline
3-ethenyl-4a,8a-dihydroquinoline (PubChem CID 70259139) has the molecular formula C11H11N
and a molecular weight of 157.22 g/mol. Its IUPAC name is 3-ethenyl-4a,8a-dihydroquinoline.
Molecular Properties
| Compound Name | 3-ethenyl-4a,8a-dihydroquinoline |
| PubChem CID | 70259139 |
| Molecular Formula | C11H11N |
| Molecular Weight | 157.22 g/mol |
| Exact Mass | 157.09 |
| IUPAC Name | 3-ethenyl-4a,8a-dihydroquinoline |
| SMILES | C=CC1=CC2C=CC=CC2N=C1 |
| InChI | InChI=1S/C11H11N/c1-2-9-7-10-5-3-4-6-11(10)12-8-9/h2-8,10-11H,1H2 |
| InChIKey | PPGOVIPKOQGTRV-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.22 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-ethenyl-4a,8a-dihydroquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethenyl-4a,8a-dihydroquinoline?
The IUPAC name of 3-ethenyl-4a,8a-dihydroquinoline (CID 70259139) is 3-ethenyl-4a,8a-dihydroquinoline.
What is the SMILES notation for 3-ethenyl-4a,8a-dihydroquinoline?
The canonical SMILES for 3-ethenyl-4a,8a-dihydroquinoline is C=CC1=CC2C=CC=CC2N=C1.
What is the InChIKey of 3-ethenyl-4a,8a-dihydroquinoline?
The InChIKey is PPGOVIPKOQGTRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11N/c1-2-9-7-10-5-3-4-6-11(10)12-8-9/h2-8,10-11H,1H2.
What are the key properties of 3-ethenyl-4a,8a-dihydroquinoline?
3-ethenyl-4a,8a-dihydroquinoline has a molecular weight of 157.22 g/mol, XLogP of 2.29, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethenyl-4a,8a-dihydroquinoline is sourced from PubChem (CID 70259139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).