About 4-phenyl-5-prop-2-enyl-2,3-dihydrofuran
4-phenyl-5-prop-2-enyl-2,3-dihydrofuran (PubChem CID 70259373) has the molecular formula C13H14O
and a molecular weight of 186.25 g/mol. Its IUPAC name is 4-phenyl-5-prop-2-enyl-2,3-dihydrofuran.
Molecular Properties
| Compound Name | 4-phenyl-5-prop-2-enyl-2,3-dihydrofuran |
| PubChem CID | 70259373 |
| Molecular Formula | C13H14O |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.10 |
| IUPAC Name | 4-phenyl-5-prop-2-enyl-2,3-dihydrofuran |
| SMILES | C=CCC1=C(c2ccccc2)CCO1 |
| InChI | InChI=1S/C13H14O/c1-2-6-13-12(9-10-14-13)11-7-4-3-5-8-11/h2-5,7-8H,1,6,9-10H2 |
| InChIKey | IXVBBAWTOXJDIF-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-phenyl-5-prop-2-enyl-2,3-dihydrofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phenyl-5-prop-2-enyl-2,3-dihydrofuran?
The IUPAC name of 4-phenyl-5-prop-2-enyl-2,3-dihydrofuran (CID 70259373) is 4-phenyl-5-prop-2-enyl-2,3-dihydrofuran.
What is the SMILES notation for 4-phenyl-5-prop-2-enyl-2,3-dihydrofuran?
The canonical SMILES for 4-phenyl-5-prop-2-enyl-2,3-dihydrofuran is C=CCC1=C(c2ccccc2)CCO1.
What is the InChIKey of 4-phenyl-5-prop-2-enyl-2,3-dihydrofuran?
The InChIKey is IXVBBAWTOXJDIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14O/c1-2-6-13-12(9-10-14-13)11-7-4-3-5-8-11/h2-5,7-8H,1,6,9-10H2.
What are the key properties of 4-phenyl-5-prop-2-enyl-2,3-dihydrofuran?
4-phenyl-5-prop-2-enyl-2,3-dihydrofuran has a molecular weight of 186.25 g/mol, XLogP of 3.39, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenyl-5-prop-2-enyl-2,3-dihydrofuran is sourced from PubChem (CID 70259373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).