C25H29NO2 — CID 70259589
4-[2-[8-(cyclopropylamino)-5,5,8-trimethyl-6,7-dihydronaphthalen-2-yl]ethenyl]benzoic acid (PubChem CID 70259589) has the molecular formula C25H29NO2 and a molecular weight of 375.51 g/mol. Its IUPAC name is 4-[2-[8-(cyclopropylamino)-5,5,8-trimethyl-6,7-dihydronaphthalen-2-yl]ethenyl]benzoic acid.
| Compound Name | 4-[2-[8-(cyclopropylamino)-5,5,8-trimethyl-6,7-dihydronaphthalen-2-yl]ethenyl]benzoic acid |
|---|---|
| PubChem CID | 70259589 |
| Molecular Formula | C25H29NO2 |
| Molecular Weight | 375.51 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | 4-[2-[8-(cyclopropylamino)-5,5,8-trimethyl-6,7-dihydronaphthalen-2-yl]ethenyl]benzoic acid |
| SMILES | CC1(C)CCC(C)(NC2CC2)c2cc(C=Cc3ccc(C(=O)O)cc3)ccc21 |
| InChI | InChI=1S/C25H29NO2/c1-24(2)14-15-25(3,26-20-11-12-20)22-16-18(8-13-21(22)24)5-4-17-6-9-19(10-7-17)23(27)28/h4-10,13,16,20,26H,11-12,14-15H2,1-3H3,(H,27,28) |
| InChIKey | XIYDJRSXJIBDLA-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.51 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|