About [1-(2-bromophenyl)-2-cyano-2-[4-(2-methylphenyl)-1,3-thiazol-2-yl]ethenyl] prop-2-enoate
[1-(2-bromophenyl)-2-cyano-2-[4-(2-methylphenyl)-1,3-thiazol-2-yl]ethenyl] prop-2-enoate (PubChem CID 70259752) has the molecular formula C22H15BrN2O2S
and a molecular weight of 451.35 g/mol. Its IUPAC name is [1-(2-bromophenyl)-2-cyano-2-[4-(2-methylphenyl)-1,3-thiazol-2-yl]ethenyl] prop-2-enoate.
Molecular Properties
| Compound Name | [1-(2-bromophenyl)-2-cyano-2-[4-(2-methylphenyl)-1,3-thiazol-2-yl]ethenyl] prop-2-enoate |
| PubChem CID | 70259752 |
| Molecular Formula | C22H15BrN2O2S |
| Molecular Weight | 451.35 g/mol |
| Exact Mass | 450.00 |
| IUPAC Name | [1-(2-bromophenyl)-2-cyano-2-[4-(2-methylphenyl)-1,3-thiazol-2-yl]ethenyl] prop-2-enoate |
| SMILES | C=CC(=O)OC(=C(C#N)c1nc(-c2ccccc2C)cs1)c1ccccc1Br |
| InChI | InChI=1S/C22H15BrN2O2S/c1-3-20(26)27-21(16-10-6-7-11-18(16)23)17(12-24)22-25-19(13-28-22)15-9-5-4-8-14(15)2/h3-11,13H,1H2,2H3 |
| InChIKey | WCOFYBRWGAEYLI-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 62.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 451.35 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [1-(2-bromophenyl)-2-cyano-2-[4-(2-methylphenyl)-1,3-thiazol-2-yl]ethenyl] prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(2-bromophenyl)-2-cyano-2-[4-(2-methylphenyl)-1,3-thiazol-2-yl]ethenyl] prop-2-enoate?
The IUPAC name of [1-(2-bromophenyl)-2-cyano-2-[4-(2-methylphenyl)-1,3-thiazol-2-yl]ethenyl] prop-2-enoate (CID 70259752) is [1-(2-bromophenyl)-2-cyano-2-[4-(2-methylphenyl)-1,3-thiazol-2-yl]ethenyl] prop-2-enoate.
What is the SMILES notation for [1-(2-bromophenyl)-2-cyano-2-[4-(2-methylphenyl)-1,3-thiazol-2-yl]ethenyl] prop-2-enoate?
The canonical SMILES for [1-(2-bromophenyl)-2-cyano-2-[4-(2-methylphenyl)-1,3-thiazol-2-yl]ethenyl] prop-2-enoate is C=CC(=O)OC(=C(C#N)c1nc(-c2ccccc2C)cs1)c1ccccc1Br.
What is the InChIKey of [1-(2-bromophenyl)-2-cyano-2-[4-(2-methylphenyl)-1,3-thiazol-2-yl]ethenyl] prop-2-enoate?
The InChIKey is WCOFYBRWGAEYLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H15BrN2O2S/c1-3-20(26)27-21(16-10-6-7-11-18(16)23)17(12-24)22-25-19(13-28-22)15-9-5-4-8-14(15)2/h3-11,13H,1H2,2H3.
What are the key properties of [1-(2-bromophenyl)-2-cyano-2-[4-(2-methylphenyl)-1,3-thiazol-2-yl]ethenyl] prop-2-enoate?
[1-(2-bromophenyl)-2-cyano-2-[4-(2-methylphenyl)-1,3-thiazol-2-yl]ethenyl] prop-2-enoate has a molecular weight of 451.35 g/mol, XLogP of 6.00, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(2-bromophenyl)-2-cyano-2-[4-(2-methylphenyl)-1,3-thiazol-2-yl]ethenyl] prop-2-enoate is sourced from PubChem (CID 70259752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).