C18H20ClN5O4 — CID 7025998
5-[2-[4-(4-chlorobenzoyl)piperazin-1-yl]ethyliminomethyl]-1,3-diazinane-2,4,6-trione (PubChem CID 7025998) has the molecular formula C18H20ClN5O4 and a molecular weight of 405.84 g/mol. Its IUPAC name is 5-[2-[4-(4-chlorobenzoyl)piperazin-1-yl]ethyliminomethyl]-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[2-[4-(4-chlorobenzoyl)piperazin-1-yl]ethyliminomethyl]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 7025998 |
| Molecular Formula | C18H20ClN5O4 |
| Molecular Weight | 405.84 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | 5-[2-[4-(4-chlorobenzoyl)piperazin-1-yl]ethyliminomethyl]-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1NC(=O)C(/C=N/CCN2CCN(C(=O)c3ccc(Cl)cc3)CC2)C(=O)N1 |
| InChI | InChI=1S/C18H20ClN5O4/c19-13-3-1-12(2-4-13)17(27)24-9-7-23(8-10-24)6-5-20-11-14-15(25)21-18(28)22-16(14)26/h1-4,11,14H,5-10H2,(H2,21,22,25,26,28)/b20-11+ |
| InChIKey | SUMUCJHBXXQIAZ-RGVLZGJSSA-N |
| XLogP | 0.15 |
| TPSA | 111.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.84 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|