C26H37NO7 — CID 70260260
3-(3,4,5-trimethoxyphenyl)propyl (1S,3R,4R)-2-(3,3-dimethyl-2-oxopentanoyl)-2-azabicyclo[2.2.1]heptane-3-carboxylate (PubChem CID 70260260) has the molecular formula C26H37NO7 and a molecular weight of 475.58 g/mol. Its IUPAC name is 3-(3,4,5-trimethoxyphenyl)propyl (1S,3R,4R)-2-(3,3-dimethyl-2-oxopentanoyl)-2-azabicyclo[2.2.1]heptane-3-carboxylate.
| Compound Name | 3-(3,4,5-trimethoxyphenyl)propyl (1S,3R,4R)-2-(3,3-dimethyl-2-oxopentanoyl)-2-azabicyclo[2.2.1]heptane-3-carboxylate |
|---|---|
| PubChem CID | 70260260 |
| Molecular Formula | C26H37NO7 |
| Molecular Weight | 475.58 g/mol |
| Exact Mass | 475.26 |
| IUPAC Name | 3-(3,4,5-trimethoxyphenyl)propyl (1S,3R,4R)-2-(3,3-dimethyl-2-oxopentanoyl)-2-azabicyclo[2.2.1]heptane-3-carboxylate |
| SMILES | CCC(C)(C)C(=O)C(=O)N1[C@H]2CC[C@H](C2)[C@@H]1C(=O)OCCCc1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C26H37NO7/c1-7-26(2,3)23(28)24(29)27-18-11-10-17(15-18)21(27)25(30)34-12-8-9-16-13-19(31-4)22(33-6)20(14-16)32-5/h13-14,17-18,21H,7-12,15H2,1-6H3/t17-,18+,21-/m1/s1 |
| InChIKey | IYGKQFQHXNCXQR-LVCYWYKZSA-N |
| XLogP | 3.57 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.58 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|