C24H30N2 — CID 70260265
2,9-dimethyl-5-[2-(4-methylphenyl)ethyl]-6,7,8,10-tetrahydrocyclohepta[b]indol-9-amine (PubChem CID 70260265) has the molecular formula C24H30N2 and a molecular weight of 346.52 g/mol. Its IUPAC name is 2,9-dimethyl-5-[2-(4-methylphenyl)ethyl]-6,7,8,10-tetrahydrocyclohepta[b]indol-9-amine.
| Compound Name | 2,9-dimethyl-5-[2-(4-methylphenyl)ethyl]-6,7,8,10-tetrahydrocyclohepta[b]indol-9-amine |
|---|---|
| PubChem CID | 70260265 |
| Molecular Formula | C24H30N2 |
| Molecular Weight | 346.52 g/mol |
| Exact Mass | 346.24 |
| IUPAC Name | 2,9-dimethyl-5-[2-(4-methylphenyl)ethyl]-6,7,8,10-tetrahydrocyclohepta[b]indol-9-amine |
| SMILES | Cc1ccc(CCn2c3c(c4cc(C)ccc42)CC(C)(N)CCC3)cc1 |
| InChI | InChI=1S/C24H30N2/c1-17-6-9-19(10-7-17)12-14-26-22-5-4-13-24(3,25)16-21(22)20-15-18(2)8-11-23(20)26/h6-11,15H,4-5,12-14,16,25H2,1-3H3 |
| InChIKey | XZVUVAABOQHKJQ-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.52 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|