C14H20NNaO2S — CID 70260495
sodium (2S)-2-[N-(2-ethylsulfanylethyl)-4-methylanilino]propanoate (PubChem CID 70260495) has the molecular formula C14H20NNaO2S and a molecular weight of 289.38 g/mol. Its IUPAC name is sodium (2S)-2-[N-(2-ethylsulfanylethyl)-4-methylanilino]propanoate.
| Compound Name | sodium (2S)-2-[N-(2-ethylsulfanylethyl)-4-methylanilino]propanoate |
|---|---|
| PubChem CID | 70260495 |
| Molecular Formula | C14H20NNaO2S |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | sodium (2S)-2-[N-(2-ethylsulfanylethyl)-4-methylanilino]propanoate |
| SMILES | CCSCCN(c1ccc(C)cc1)[C@@H](C)C(=O)[O-].[Na+] |
| InChI | InChI=1S/C14H21NO2S.Na/c1-4-18-10-9-15(12(3)14(16)17)13-7-5-11(2)6-8-13;/h5-8,12H,4,9-10H2,1-3H3,(H,16,17);/q;+1/p-1/t12-;/m0./s1 |
| InChIKey | SNTXDBIHKWSWAX-YDALLXLXSA-M |
| XLogP | -1.30 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|