C25H30N4O — CID 70260624
1-[2-[8-methyl-5-(2-phenylethyl)-3,4-dihydro-1H-pyrido[4,3-b]indol-2-yl]ethyl]imidazolidin-2-one (PubChem CID 70260624) has the molecular formula C25H30N4O and a molecular weight of 402.54 g/mol. Its IUPAC name is 1-[2-[8-methyl-5-(2-phenylethyl)-3,4-dihydro-1H-pyrido[4,3-b]indol-2-yl]ethyl]imidazolidin-2-one.
| Compound Name | 1-[2-[8-methyl-5-(2-phenylethyl)-3,4-dihydro-1H-pyrido[4,3-b]indol-2-yl]ethyl]imidazolidin-2-one |
|---|---|
| PubChem CID | 70260624 |
| Molecular Formula | C25H30N4O |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.24 |
| IUPAC Name | 1-[2-[8-methyl-5-(2-phenylethyl)-3,4-dihydro-1H-pyrido[4,3-b]indol-2-yl]ethyl]imidazolidin-2-one |
| SMILES | Cc1ccc2c(c1)c1c(n2CCc2ccccc2)CCN(CCN2CCNC2=O)C1 |
| InChI | InChI=1S/C25H30N4O/c1-19-7-8-23-21(17-19)22-18-27(15-16-28-14-11-26-25(28)30)12-10-24(22)29(23)13-9-20-5-3-2-4-6-20/h2-8,17H,9-16,18H2,1H3,(H,26,30) |
| InChIKey | VKDMDOSVBLUKAJ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 40.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|