About ethyl 2,2-difluoro-2-pyridin-2-ylacetate;ethyl 2-oxo-2-pyridin-2-ylacetate
ethyl 2,2-difluoro-2-pyridin-2-ylacetate;ethyl 2-oxo-2-pyridin-2-ylacetate (PubChem CID 70260881) has the molecular formula C18H18F2N2O5
and a molecular weight of 380.35 g/mol. Its IUPAC name is ethyl 2,2-difluoro-2-pyridin-2-ylacetate;ethyl 2-oxo-2-pyridin-2-ylacetate.
Molecular Properties
| Compound Name | ethyl 2,2-difluoro-2-pyridin-2-ylacetate;ethyl 2-oxo-2-pyridin-2-ylacetate |
| PubChem CID | 70260881 |
| Molecular Formula | C18H18F2N2O5 |
| Molecular Weight | 380.35 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | ethyl 2,2-difluoro-2-pyridin-2-ylacetate;ethyl 2-oxo-2-pyridin-2-ylacetate |
| SMILES | CCOC(=O)C(=O)c1ccccn1.CCOC(=O)C(F)(F)c1ccccn1 |
| InChI | InChI=1S/C9H9F2NO2.C9H9NO3/c1-2-14-8(13)9(10,11)7-5-3-4-6-12-7;1-2-13-9(12)8(11)7-5-3-4-6-10-7/h3-6H,2H2,1H3;3-6H,2H2,1H3 |
| InChIKey | NSHDQOQQWPGVMU-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 95.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.35 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2,2-difluoro-2-pyridin-2-ylacetate;ethyl 2-oxo-2-pyridin-2-ylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2,2-difluoro-2-pyridin-2-ylacetate;ethyl 2-oxo-2-pyridin-2-ylacetate?
The IUPAC name of ethyl 2,2-difluoro-2-pyridin-2-ylacetate;ethyl 2-oxo-2-pyridin-2-ylacetate (CID 70260881) is ethyl 2,2-difluoro-2-pyridin-2-ylacetate;ethyl 2-oxo-2-pyridin-2-ylacetate.
What is the SMILES notation for ethyl 2,2-difluoro-2-pyridin-2-ylacetate;ethyl 2-oxo-2-pyridin-2-ylacetate?
The canonical SMILES for ethyl 2,2-difluoro-2-pyridin-2-ylacetate;ethyl 2-oxo-2-pyridin-2-ylacetate is CCOC(=O)C(=O)c1ccccn1.CCOC(=O)C(F)(F)c1ccccn1.
What is the InChIKey of ethyl 2,2-difluoro-2-pyridin-2-ylacetate;ethyl 2-oxo-2-pyridin-2-ylacetate?
The InChIKey is NSHDQOQQWPGVMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9F2NO2.C9H9NO3/c1-2-14-8(13)9(10,11)7-5-3-4-6-12-7;1-2-13-9(12)8(11)7-5-3-4-6-10-7/h3-6H,2H2,1H3;3-6H,2H2,1H3.
What are the key properties of ethyl 2,2-difluoro-2-pyridin-2-ylacetate;ethyl 2-oxo-2-pyridin-2-ylacetate?
ethyl 2,2-difluoro-2-pyridin-2-ylacetate;ethyl 2-oxo-2-pyridin-2-ylacetate has a molecular weight of 380.35 g/mol, XLogP of 2.56, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2,2-difluoro-2-pyridin-2-ylacetate;ethyl 2-oxo-2-pyridin-2-ylacetate is sourced from PubChem (CID 70260881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).