C26H25N3O3 — CID 70261169
N-[1-cyclohexa-1,3-dien-1-yl-4-(3-methoxyphenyl)imidazol-2-yl]-4-[(E)-2-methoxyethenyl]benzamide (PubChem CID 70261169) has the molecular formula C26H25N3O3 and a molecular weight of 427.50 g/mol. Its IUPAC name is N-[1-cyclohexa-1,3-dien-1-yl-4-(3-methoxyphenyl)imidazol-2-yl]-4-[(E)-2-methoxyethenyl]benzamide.
| Compound Name | N-[1-cyclohexa-1,3-dien-1-yl-4-(3-methoxyphenyl)imidazol-2-yl]-4-[(E)-2-methoxyethenyl]benzamide |
|---|---|
| PubChem CID | 70261169 |
| Molecular Formula | C26H25N3O3 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | N-[1-cyclohexa-1,3-dien-1-yl-4-(3-methoxyphenyl)imidazol-2-yl]-4-[(E)-2-methoxyethenyl]benzamide |
| SMILES | CO/C=C/c1ccc(C(=O)Nc2nc(-c3cccc(OC)c3)cn2C2=CC=CCC2)cc1 |
| InChI | InChI=1S/C26H25N3O3/c1-31-16-15-19-11-13-20(14-12-19)25(30)28-26-27-24(21-7-6-10-23(17-21)32-2)18-29(26)22-8-4-3-5-9-22/h3-4,6-8,10-18H,5,9H2,1-2H3,(H,27,28,30)/b16-15+ |
| InChIKey | YYBAWSFEQXZRPL-FOCLMDBBSA-N |
| XLogP | 5.62 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|