C24H32N4 — CID 70261579
5-[2-(3,4-dihydropyridin-6-yl)ethyl]-8-methyl-2-piperidin-4-yl-3,4-dihydro-1H-pyrido[4,3-b]indole (PubChem CID 70261579) has the molecular formula C24H32N4 and a molecular weight of 376.55 g/mol. Its IUPAC name is 5-[2-(3,4-dihydropyridin-6-yl)ethyl]-8-methyl-2-piperidin-4-yl-3,4-dihydro-1H-pyrido[4,3-b]indole.
| Compound Name | 5-[2-(3,4-dihydropyridin-6-yl)ethyl]-8-methyl-2-piperidin-4-yl-3,4-dihydro-1H-pyrido[4,3-b]indole |
|---|---|
| PubChem CID | 70261579 |
| Molecular Formula | C24H32N4 |
| Molecular Weight | 376.55 g/mol |
| Exact Mass | 376.26 |
| IUPAC Name | 5-[2-(3,4-dihydropyridin-6-yl)ethyl]-8-methyl-2-piperidin-4-yl-3,4-dihydro-1H-pyrido[4,3-b]indole |
| SMILES | Cc1ccc2c(c1)c1c(n2CCC2=CCCC=N2)CCN(C2CCNCC2)C1 |
| InChI | InChI=1S/C24H32N4/c1-18-5-6-23-21(16-18)22-17-27(20-7-12-25-13-8-20)14-10-24(22)28(23)15-9-19-4-2-3-11-26-19/h4-6,11,16,20,25H,2-3,7-10,12-15,17H2,1H3 |
| InChIKey | ZALODCXXINJDAY-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 32.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.55 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|