About 3-[(4,6-dimethylpyrimidin-2-yl)amino]phenol
3-[(4,6-dimethylpyrimidin-2-yl)amino]phenol (PubChem CID 702623) has the molecular formula C12H13N3O
and a molecular weight of 215.26 g/mol. Its IUPAC name is 3-[(4,6-dimethylpyrimidin-2-yl)amino]phenol.
Molecular Properties
| Compound Name | 3-[(4,6-dimethylpyrimidin-2-yl)amino]phenol |
| PubChem CID | 702623 |
| Molecular Formula | C12H13N3O |
| Molecular Weight | 215.26 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | 3-[(4,6-dimethylpyrimidin-2-yl)amino]phenol |
| SMILES | Cc1cc(C)nc(Nc2cccc(O)c2)n1 |
| InChI | InChI=1S/C12H13N3O/c1-8-6-9(2)14-12(13-8)15-10-4-3-5-11(16)7-10/h3-7,16H,1-2H3,(H,13,14,15) |
| InChIKey | HLDRMBWIBILLLN-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.26 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[(4,6-dimethylpyrimidin-2-yl)amino]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4,6-dimethylpyrimidin-2-yl)amino]phenol?
The IUPAC name of 3-[(4,6-dimethylpyrimidin-2-yl)amino]phenol (CID 702623) is 3-[(4,6-dimethylpyrimidin-2-yl)amino]phenol.
What is the SMILES notation for 3-[(4,6-dimethylpyrimidin-2-yl)amino]phenol?
The canonical SMILES for 3-[(4,6-dimethylpyrimidin-2-yl)amino]phenol is Cc1cc(C)nc(Nc2cccc(O)c2)n1.
What is the InChIKey of 3-[(4,6-dimethylpyrimidin-2-yl)amino]phenol?
The InChIKey is HLDRMBWIBILLLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13N3O/c1-8-6-9(2)14-12(13-8)15-10-4-3-5-11(16)7-10/h3-7,16H,1-2H3,(H,13,14,15).
What are the key properties of 3-[(4,6-dimethylpyrimidin-2-yl)amino]phenol?
3-[(4,6-dimethylpyrimidin-2-yl)amino]phenol has a molecular weight of 215.26 g/mol, XLogP of 2.54, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4,6-dimethylpyrimidin-2-yl)amino]phenol is sourced from PubChem (CID 702623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).