C21H25F3N2 — CID 70262330
6-[cyclohexa-1,3-dien-1-yl-[(1S)-cyclohex-3-en-1-yl]methyl]-3-(trifluoromethyl)-1,5,7,7a-tetrahydropyrrolo[3,4-b]pyridine (PubChem CID 70262330) has the molecular formula C21H25F3N2 and a molecular weight of 362.44 g/mol. Its IUPAC name is 6-[cyclohexa-1,3-dien-1-yl-[(1S)-cyclohex-3-en-1-yl]methyl]-3-(trifluoromethyl)-1,5,7,7a-tetrahydropyrrolo[3,4-b]pyridine.
| Compound Name | 6-[cyclohexa-1,3-dien-1-yl-[(1S)-cyclohex-3-en-1-yl]methyl]-3-(trifluoromethyl)-1,5,7,7a-tetrahydropyrrolo[3,4-b]pyridine |
|---|---|
| PubChem CID | 70262330 |
| Molecular Formula | C21H25F3N2 |
| Molecular Weight | 362.44 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | 6-[cyclohexa-1,3-dien-1-yl-[(1S)-cyclohex-3-en-1-yl]methyl]-3-(trifluoromethyl)-1,5,7,7a-tetrahydropyrrolo[3,4-b]pyridine |
| SMILES | FC(F)(F)C1=CNC2CN(C(C3=CC=CCC3)[C@@H]3CC=CCC3)CC2=C1 |
| InChI | InChI=1S/C21H25F3N2/c22-21(23,24)18-11-17-13-26(14-19(17)25-12-18)20(15-7-3-1-4-8-15)16-9-5-2-6-10-16/h1-3,5,7,11-12,16,19-20,25H,4,6,8-10,13-14H2/t16-,19?,20?/m1/s1 |
| InChIKey | FQDROETXIBISPZ-PBPGXSGUSA-N |
| XLogP | 4.65 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.44 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|