About 5-[3-(4-Ethylphenyl)-2-phenylpropyl]cyclohexa-1,3-dien-1-amine
5-[3-(4-Ethylphenyl)-2-phenylpropyl]cyclohexa-1,3-dien-1-amine (PubChem CID 70262358) has the molecular formula C23H27N
and a molecular weight of 317.50 g/mol. Its IUPAC name is 5-[3-(4-ethylphenyl)-2-phenylpropyl]cyclohexa-1,3-dien-1-amine.
Molecular Properties
| Compound Name | 5-[3-(4-Ethylphenyl)-2-phenylpropyl]cyclohexa-1,3-dien-1-amine |
| PubChem CID | 70262358 |
| Molecular Formula | C23H27N |
| Molecular Weight | 317.50 g/mol |
| Exact Mass | 317.21 |
| IUPAC Name | 5-[3-(4-ethylphenyl)-2-phenylpropyl]cyclohexa-1,3-dien-1-amine |
| SMILES | CCC1=CC=C(C=C1)CC(CC2CC(=CC=C2)N)C3=CC=CC=C3 |
| InChI | InChI=1S/C23H27N/c1-2-18-11-13-19(14-12-18)15-22(21-8-4-3-5-9-21)16-20-7-6-10-23(24)17-20/h3-14,20,22H,2,15-17,24H2,1H3 |
| InChIKey | HHCJHCCIAQIIDC-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 26.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | 421 |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 317.50 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-[3-(4-Ethylphenyl)-2-phenylpropyl]cyclohexa-1,3-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[3-(4-Ethylphenyl)-2-phenylpropyl]cyclohexa-1,3-dien-1-amine?
The IUPAC name of 5-[3-(4-Ethylphenyl)-2-phenylpropyl]cyclohexa-1,3-dien-1-amine (CID 70262358) is 5-[3-(4-ethylphenyl)-2-phenylpropyl]cyclohexa-1,3-dien-1-amine.
What is the SMILES notation for 5-[3-(4-Ethylphenyl)-2-phenylpropyl]cyclohexa-1,3-dien-1-amine?
The canonical SMILES for 5-[3-(4-Ethylphenyl)-2-phenylpropyl]cyclohexa-1,3-dien-1-amine is CCC1=CC=C(C=C1)CC(CC2CC(=CC=C2)N)C3=CC=CC=C3.
What is the InChIKey of 5-[3-(4-Ethylphenyl)-2-phenylpropyl]cyclohexa-1,3-dien-1-amine?
The InChIKey is HHCJHCCIAQIIDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H27N/c1-2-18-11-13-19(14-12-18)15-22(21-8-4-3-5-9-21)16-20-7-6-10-23(24)17-20/h3-14,20,22H,2,15-17,24H2,1H3.
What are the key properties of 5-[3-(4-Ethylphenyl)-2-phenylpropyl]cyclohexa-1,3-dien-1-amine?
5-[3-(4-Ethylphenyl)-2-phenylpropyl]cyclohexa-1,3-dien-1-amine has a molecular weight of 317.50 g/mol, XLogP of 6.00, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[3-(4-Ethylphenyl)-2-phenylpropyl]cyclohexa-1,3-dien-1-amine is sourced from PubChem (CID 70262358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).