About N,N-dimethylmethanamine;2-methyl-2-azabicyclo[3.1.0]hexane
N,N-dimethylmethanamine;2-methyl-2-azabicyclo[3.1.0]hexane (PubChem CID 70262925) has the molecular formula C9H20N2
and a molecular weight of 156.27 g/mol. Its IUPAC name is N,N-dimethylmethanamine;2-methyl-2-azabicyclo[3.1.0]hexane.
Molecular Properties
| Compound Name | N,N-dimethylmethanamine;2-methyl-2-azabicyclo[3.1.0]hexane |
| PubChem CID | 70262925 |
| Molecular Formula | C9H20N2 |
| Molecular Weight | 156.27 g/mol |
| Exact Mass | 156.16 |
| IUPAC Name | N,N-dimethylmethanamine;2-methyl-2-azabicyclo[3.1.0]hexane |
| SMILES | CN(C)C.CN1CCC2CC21 |
| InChI | InChI=1S/C6H11N.C3H9N/c1-7-3-2-5-4-6(5)7;1-4(2)3/h5-6H,2-4H2,1H3;1-3H3 |
| InChIKey | RUVIVPUYILNQDU-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.27 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N,N-dimethylmethanamine;2-methyl-2-azabicyclo[3.1.0]hexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylmethanamine;2-methyl-2-azabicyclo[3.1.0]hexane?
The IUPAC name of N,N-dimethylmethanamine;2-methyl-2-azabicyclo[3.1.0]hexane (CID 70262925) is N,N-dimethylmethanamine;2-methyl-2-azabicyclo[3.1.0]hexane.
What is the SMILES notation for N,N-dimethylmethanamine;2-methyl-2-azabicyclo[3.1.0]hexane?
The canonical SMILES for N,N-dimethylmethanamine;2-methyl-2-azabicyclo[3.1.0]hexane is CN(C)C.CN1CCC2CC21.
What is the InChIKey of N,N-dimethylmethanamine;2-methyl-2-azabicyclo[3.1.0]hexane?
The InChIKey is RUVIVPUYILNQDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N.C3H9N/c1-7-3-2-5-4-6(5)7;1-4(2)3/h5-6H,2-4H2,1H3;1-3H3.
What are the key properties of N,N-dimethylmethanamine;2-methyl-2-azabicyclo[3.1.0]hexane?
N,N-dimethylmethanamine;2-methyl-2-azabicyclo[3.1.0]hexane has a molecular weight of 156.27 g/mol, XLogP of 0.89, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylmethanamine;2-methyl-2-azabicyclo[3.1.0]hexane is sourced from PubChem (CID 70262925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).