About (E)-7-[2,3-difluoro-4-(6-prop-2-enoxypyridazin-3-yl)phenyl]hept-6-en-2-ol
(E)-7-[2,3-difluoro-4-(6-prop-2-enoxypyridazin-3-yl)phenyl]hept-6-en-2-ol (PubChem CID 70263081) has the molecular formula C20H22F2N2O2
and a molecular weight of 360.40 g/mol. Its IUPAC name is (E)-7-[2,3-difluoro-4-(6-prop-2-enoxypyridazin-3-yl)phenyl]hept-6-en-2-ol.
Molecular Properties
| Compound Name | (E)-7-[2,3-difluoro-4-(6-prop-2-enoxypyridazin-3-yl)phenyl]hept-6-en-2-ol |
| PubChem CID | 70263081 |
| Molecular Formula | C20H22F2N2O2 |
| Molecular Weight | 360.40 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | (E)-7-[2,3-difluoro-4-(6-prop-2-enoxypyridazin-3-yl)phenyl]hept-6-en-2-ol |
| SMILES | C=CCOc1ccc(-c2ccc(/C=C/CCCC(C)O)c(F)c2F)nn1 |
| InChI | InChI=1S/C20H22F2N2O2/c1-3-13-26-18-12-11-17(23-24-18)16-10-9-15(19(21)20(16)22)8-6-4-5-7-14(2)25/h3,6,8-12,14,25H,1,4-5,7,13H2,2H3/b8-6+ |
| InChIKey | FAUOHWKQSXVUGC-SOFGYWHQSA-N |
| XLogP | 4.55 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.40 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-7-[2,3-difluoro-4-(6-prop-2-enoxypyridazin-3-yl)phenyl]hept-6-en-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-7-[2,3-difluoro-4-(6-prop-2-enoxypyridazin-3-yl)phenyl]hept-6-en-2-ol?
The IUPAC name of (E)-7-[2,3-difluoro-4-(6-prop-2-enoxypyridazin-3-yl)phenyl]hept-6-en-2-ol (CID 70263081) is (E)-7-[2,3-difluoro-4-(6-prop-2-enoxypyridazin-3-yl)phenyl]hept-6-en-2-ol.
What is the SMILES notation for (E)-7-[2,3-difluoro-4-(6-prop-2-enoxypyridazin-3-yl)phenyl]hept-6-en-2-ol?
The canonical SMILES for (E)-7-[2,3-difluoro-4-(6-prop-2-enoxypyridazin-3-yl)phenyl]hept-6-en-2-ol is C=CCOc1ccc(-c2ccc(/C=C/CCCC(C)O)c(F)c2F)nn1.
What is the InChIKey of (E)-7-[2,3-difluoro-4-(6-prop-2-enoxypyridazin-3-yl)phenyl]hept-6-en-2-ol?
The InChIKey is FAUOHWKQSXVUGC-SOFGYWHQSA-N. The full InChI is InChI=1S/C20H22F2N2O2/c1-3-13-26-18-12-11-17(23-24-18)16-10-9-15(19(21)20(16)22)8-6-4-5-7-14(2)25/h3,6,8-12,14,25H,1,4-5,7,13H2,2H3/b8-6+.
What are the key properties of (E)-7-[2,3-difluoro-4-(6-prop-2-enoxypyridazin-3-yl)phenyl]hept-6-en-2-ol?
(E)-7-[2,3-difluoro-4-(6-prop-2-enoxypyridazin-3-yl)phenyl]hept-6-en-2-ol has a molecular weight of 360.40 g/mol, XLogP of 4.55, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-7-[2,3-difluoro-4-(6-prop-2-enoxypyridazin-3-yl)phenyl]hept-6-en-2-ol is sourced from PubChem (CID 70263081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).